3622-04-6 1,3-Benzothiazole-2-carboxylic acid

상품명칭	1,3-Benzothiazole-2-carboxylic acid
영문 이름	1,3-Benzothiazole-2-carboxylic acid; benzo[d]thiazole-2-carboxylic acid
분자식	C₈H₅NO₂S
분자량	179.1958
InChI	InChI=1/C8H5NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4H,(H,10,11)
cas번호	3622-04-6
분자 구조
밀도	1.508g/cm³
녹는 점	148℃
비등점	378.5°C at 760 mmHg
굴절 지수	1.731
인화점	182.7°C
증기압	2.11E-06mmHg at 25°C
위험성 표시	Xn:Harmful;
리스크 규칙	R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;