ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
| 상품명칭 |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
| 영문 이름 |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile;1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
| 분자식 |
C14H17NO |
| 분자량 |
215.2909 |
| InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| cas번호 |
36263-51-1 |
| EC번호 |
252-938-7 |
| 분자 구조 |
|
| 밀도 |
1.06g/cm3 |
| 녹는 점 |
40-45℃ |
| 비등점 |
362°C at 760 mmHg |
| 굴절 지수 |
1.538 |
| 인화점 |
152.6°C |
| 증기압 |
2E-05mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
