ChemNet > CAS > 3658-48-8 bis(2-ethylhexyl) phosphite
3658-48-8 bis(2-ethylhexyl) phosphite
| 상품명칭 |
bis(2-ethylhexyl) phosphite |
| 영문 이름 |
bis(2-ethylhexyl) phosphite; Bis-(2-ethylhexyl)-phosphite; bis(2-ethylhexyl) phosphonate; Phosphorous acid bis(2-ethylhexyl) ester; bis(2-ethylhexyl) hydrogen phosphite; bis[(2-ethylhexyl)oxy](oxo)phosphonium; Bis(2-ethylhexyl)phosphoric acid |
| 분자식 |
C16H34O3P |
| 분자량 |
305.4126 |
| InChI |
InChI=1/C16H34O3P/c1-5-9-11-15(7-3)13-18-20(17)19-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3/q+1 |
| cas번호 |
3658-48-8 |
| EC번호 |
222-904-6 |
| 분자 구조 |
|
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
