ChemNet > CAS > 36919-03-6 Methyl pentafluorophenyl carbonate
36919-03-6 Methyl pentafluorophenyl carbonate
상품명칭 |
Methyl pentafluorophenyl carbonate |
영문 이름 |
Methyl pentafluorophenyl carbonate; Pentafluorophenyl methyl carbonate |
분자식 |
C8H3F5O3 |
분자량 |
242.0996 |
InChI |
InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
cas번호 |
36919-03-6 |
분자 구조 |
|
밀도 |
1.567g/cm3 |
비등점 |
207.5°C at 760 mmHg |
굴절 지수 |
1.422 |
인화점 |
77.3°C |
증기압 |
0.224mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|