ChemNet > CAS > 3696-28-4 2,2'-Dithiobis(pyridine-N-oxide)
3696-28-4 2,2'-Dithiobis(pyridine-N-oxide)
| 상품명칭 |
2,2'-Dithiobis(pyridine-N-oxide) |
| 영문 이름 |
2,2'-Dithiobis(pyridine-N-oxide); dipyrithione; BISPYRITHIONE; 2,2'-Dithiobis (pyridine-N-oxide); 2,2'-disulfanediylbis(pyridine) 1,1'-dioxide |
| 분자식 |
C10H8N2O2S2 |
| 분자량 |
252.3127 |
| InChI |
InChI=1/C10H8N2O2S2/c13-11-7-3-1-5-9(11)15-16-10-6-2-4-8-12(10)14/h1-8H |
| cas번호 |
3696-28-4 |
| EC번호 |
223-024-5 |
| 분자 구조 |
|
| 밀도 |
1.38g/cm3 |
| 녹는 점 |
205℃ |
| 비등점 |
582.8°C at 760 mmHg |
| 굴절 지수 |
1.681 |
| 인화점 |
306.2°C |
| 증기압 |
5.82E-13mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
