37107-50-9 Cyclohexylidenecyanoacetic acid

상품명칭	Cyclohexylidenecyanoacetic acid
영문 이름	Cyclohexylidenecyanoacetic acid;Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid
분자식	C₉H₁₁NO₂
분자량	165.1891
InChI	InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12)
cas번호	37107-50-9
EC번호	253-351-9
분자 구조
밀도	1.211g/cm³
비등점	353.9°C at 760 mmHg
굴절 지수	1.537
인화점	167.8°C
증기압	5.84E-06mmHg at 25°C
위험성 표시
리스크 규칙	R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;