ChemNet > CAS > 3715-29-5 3-Methyl-2-oxobutanoic acid, sodium salt
3715-29-5 3-Methyl-2-oxobutanoic acid, sodium salt
상품명칭 |
3-Methyl-2-oxobutanoic acid, sodium salt |
영문 이름 |
3-Methyl-2-oxobutanoic acid, sodium salt; 3-methyl-2-oxobutyric acid sodium salt; A-ketoisovaleric acid sodium; sodium 3-methyl-2-oxobutanoate; Sodium 3-methyl-2-oxobutyrate; 3-Methyl-2-oxobutanoic acid sodium salt; 3-methyl-2-oxobutanoic acid; 3-methyl-2-oxobutanoate |
분자식 |
C5H7O3 |
분자량 |
115.1078 |
InChI |
InChI=1/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8)/p-1 |
cas번호 |
3715-29-5 |
EC번호 |
223-062-2 |
분자 구조 |
|
녹는 점 |
227-230℃ (dec.) |
비등점 |
170.2°C at 760 mmHg |
인화점 |
71°C |
증기압 |
0.732mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|