ChemNet > CAS > 374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
상품명칭 |
4-Bromo-2,3-difluorobenzeneboronic acid |
영문 이름 |
4-Bromo-2,3-difluorobenzeneboronic acid; 4-Bromo-2,3-difluorophenylboronic acid |
분자식 |
C6H4BBrF2O2 |
분자량 |
236.8066 |
InChI |
InChI=1/C6H4BBrF2O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
cas번호 |
374790-99-5 |
분자 구조 |
|
밀도 |
1.82g/cm3 |
비등점 |
312.6°C at 760 mmHg |
굴절 지수 |
1.547 |
인화점 |
142.8°C |
증기압 |
0.000224mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|