37529-30-9 4-decylaniline
상품명칭 |
4-decylaniline |
영문 이름 |
4-decylaniline; 4-n-Decylaniline |
분자식 |
C16H27N |
분자량 |
233.3923 |
InChI |
InChI=1/C16H27N/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h11-14H,2-10,17H2,1H3 |
cas번호 |
37529-30-9 |
EC번호 |
253-546-9 |
분자 구조 |
|
밀도 |
0.909g/cm3 |
녹는 점 |
25℃ |
비등점 |
364.4°C at 760 mmHg |
굴절 지수 |
1.512 |
인화점 |
150°C |
증기압 |
1.69E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|