ChemNet > CAS > 38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
상품명칭 |
4,5-Dibromothiophene-2-carboxaldehyde |
영문 이름 |
4,5-Dibromothiophene-2-carboxaldehyde;4,5-dibromothiophene-2-carbaldehyde |
분자식 |
C5H2Br2OS |
분자량 |
269.9418 |
InChI |
InChI=1/C5H2Br2OS/c6-4-1-3(2-8)9-5(4)7/h1-2H |
cas번호 |
38071-22-6 |
분자 구조 |
|
밀도 |
2.195g/cm3 |
녹는 점 |
79℃ |
비등점 |
306.1°C at 760 mmHg |
굴절 지수 |
1.685 |
인화점 |
138.9°C |
증기압 |
0.00079mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|