38291-82-6 Valeric acid hydrazide
상품명칭 |
Valeric acid hydrazide |
영문 이름 |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
분자식 |
C5H12N2O |
분자량 |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
cas번호 |
38291-82-6 |
EC번호 |
253-864-8 |
분자 구조 |
|
밀도 |
0.962g/cm3 |
비등점 |
260.6°C at 760 mmHg |
굴절 지수 |
1.449 |
인화점 |
111.4°C |
증기압 |
0.0122mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|