ChemNet > CAS > 38594-42-2 Dichlorobenzylalcohol; 98%
38594-42-2 Dichlorobenzylalcohol; 98%
상품명칭 |
Dichlorobenzylalcohol; 98% |
영문 이름 |
Dichlorobenzylalcohol; 98%; 2,3-Dichlorobenzyl alcohol; (2,3-dichlorophenyl)methanol |
분자식 |
C7H6Cl2O |
분자량 |
177.0279 |
InChI |
InChI=1/C7H6Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4H2 |
cas번호 |
38594-42-2 |
분자 구조 |
|
밀도 |
1.392g/cm3 |
녹는 점 |
85-88℃ |
비등점 |
271.2°C at 760 mmHg |
굴절 지수 |
1.582 |
인화점 |
115.8°C |
증기압 |
0.00321mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|