38690-76-5 4-시아노페닐 4-헵틸벤조에이트
상품명칭 |
4-시아노페닐 4-헵틸벤조에이트 |
별명 |
; 4-n-헵틸벤조산 4-시아노페닐 에스테르 |
영문 이름 |
4-Cyanophenyl 4-heptylbenzoate; 4-n-Heptylbenzoic acid 4-Cyanophenyl ester |
분자식 |
C21H23NO2 |
분자량 |
321.4128 |
InChI |
InChI=1/C21H23NO2/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)21(23)24-20-14-10-18(16-22)11-15-20/h8-15H,2-7H2,1H3 |
cas번호 |
38690-76-5 |
EC번호 |
254-084-0 |
분자 구조 |
|
밀도 |
1.09g/cm3 |
녹는 점 |
43-45℃ |
비등점 |
476.4°C at 760 mmHg |
굴절 지수 |
1.56 |
인화점 |
238.3°C |
증기압 |
3.07E-09mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|