ChemNet > CAS > 38861-78-8 4-Isobutylacetophenone
38861-78-8 4-Isobutylacetophenone
| 상품명칭 |
4-Isobutylacetophenone |
| 영문 이름 |
4-Isobutylacetophenone; 4-Isobutylacetaphenone; TIMTEC-BB SBB007668; P-ISO-BUTYLACETOPHENONE; IBUPROFEN IMPURITY E; IBUPROFEN IMP E; ISOBUTYL ACETOPHENONE; 4'-ISOBUTYLACETOPHENONE; 1-[4-(2-METHYLPROPYL)PHENYL]ETHANONE; 4-methyl-3-phenylpentan-2-one; 4'-(2-Methylpropyl)Acetophenone; 1Y1&1R DV1 |
| 분자식 |
C12H16O |
| 분자량 |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-9(2)12(10(3)13)11-7-5-4-6-8-11/h4-9,12H,1-3H3 |
| cas번호 |
38861-78-8 |
| EC번호 |
254-159-8 |
| 분자 구조 |
|
| 밀도 |
0.944g/cm3 |
| 비등점 |
240.8°C at 760 mmHg |
| 굴절 지수 |
1.494 |
| 인화점 |
87°C |
| 증기압 |
0.0372mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
