ChemNet > CAS > 38940-62-4 Ethanone, 1-(5-bromo-3-pyridinyl)-
38940-62-4 Ethanone, 1-(5-bromo-3-pyridinyl)-
상품명칭 |
Ethanone, 1-(5-bromo-3-pyridinyl)- |
영문 이름 |
Ethanone, 1-(5-bromo-3-pyridinyl)-; 3-Acetyl-5-bromopyridine; 1-(5-bromopyridin-3-yl)ethanone |
분자식 |
C7H6BrNO |
분자량 |
200.0326 |
InChI |
InChI=1/C7H6BrNO/c1-5(10)6-2-7(8)4-9-3-6/h2-4H,1H3 |
cas번호 |
38940-62-4 |
분자 구조 |
|
밀도 |
1.534g/cm3 |
비등점 |
279.321°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
122.729°C |
증기압 |
0.004mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|