ChemNet > CAS > 39101-54-7 3,5-Dimethylphenylacetonitrile
39101-54-7 3,5-Dimethylphenylacetonitrile
| 상품명칭 |
3,5-Dimethylphenylacetonitrile |
| 영문 이름 |
3,5-Dimethylphenylacetonitrile; 3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
| 분자식 |
C10H11N |
| 분자량 |
145.201 |
| InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
| cas번호 |
39101-54-7 |
| EC번호 |
254-292-1 |
| 분자 구조 |
|
| 밀도 |
0.979g/cm3 |
| 비등점 |
254.5°C at 760 mmHg |
| 굴절 지수 |
1.524 |
| 인화점 |
117.5°C |
| 증기압 |
0.0172mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
