ChemNet > CAS > 39156-41-7 2,4-Diaminoanisole sulfate
39156-41-7 2,4-Diaminoanisole sulfate
| 상품명칭 |
2,4-Diaminoanisole sulfate |
| 영문 이름 |
2,4-Diaminoanisole sulfate; C.I. 76051; C.I. Oxidation Base 12A |
| 분자식 |
C7H10N2O・H2SO4 |
| 분자량 |
236.24 |
| InChI |
InChI=1/C7H10N2O.H2O4S/c1-10-7-3-2-5(8)4-6(7)9;1-5(2,3)4/h2-4H,8-9H2,1H3;(H2,1,2,3,4) |
| cas번호 |
39156-41-7 |
| EC번호 |
254-323-9 |
| 분자 구조 |
|
| 녹는 점 |
189-192℃ |
| 물 용해도 |
Soluble. 1-5 g/100 mL at 18.5℃ |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R23/24:Toxic by inhalation and in contact with skin.;
R33:Danger of cummulative effects.;
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
