ChemNet > CAS > 392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
상품명칭 |
Methyl 4-fluoro-2-hydroxybenzoate |
영문 이름 |
Methyl 4-fluoro-2-hydroxybenzoate; Methyl 4-fluorosalicylate; 4-Fluorosalicylic acid methyl ester; Methyl 4-fluoro-2-hydroxybenzoate; 4-Fluoro-6-hydroxy-benzoic acid methyl ester |
분자식 |
C8H7FO3 |
분자량 |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3 |
cas번호 |
392-04-1 |
분자 구조 |
|
밀도 |
1.309g/cm3 |
비등점 |
224.7°C at 760 mmHg |
굴절 지수 |
1.526 |
인화점 |
89.7°C |
증기압 |
0.0603mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|