ChemNet > CAS > 394-29-6 5-Chloro-2-fluorobenzoyl chloride
394-29-6 5-Chloro-2-fluorobenzoyl chloride
상품명칭 |
5-Chloro-2-fluorobenzoyl chloride |
영문 이름 |
5-Chloro-2-fluorobenzoyl chloride; 5-Chloro-2-fluorobenzyl chloride; 2-Fluoro-5-Chorobenzoyl Chloride |
분자식 |
C7H3Cl2FO |
분자량 |
193.0025 |
InChI |
InChI=1/C7H3Cl2FO/c8-4-1-2-6(10)5(3-4)7(9)11/h1-3H |
cas번호 |
394-29-6 |
분자 구조 |
|
밀도 |
1.462g/cm3 |
비등점 |
213°C at 760 mmHg |
굴절 지수 |
1.539 |
인화점 |
82.6°C |
증기압 |
0.168mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|