ChemNet > CAS > 3943-73-5 ethyl 2,3-dihydroxybenzoate
3943-73-5 ethyl 2,3-dihydroxybenzoate
상품명칭 |
ethyl 2,3-dihydroxybenzoate |
영문 이름 |
ethyl 2,3-dihydroxybenzoate; 2,3-Dihydroxy-benzoic acid ethyl ester |
분자식 |
C9H10O4 |
분자량 |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,10-11H,2H2,1H3 |
cas번호 |
3943-73-5 |
분자 구조 |
|
밀도 |
1.294g/cm3 |
녹는 점 |
65℃ |
비등점 |
307.2°C at 760 mmHg |
굴절 지수 |
1.573 |
인화점 |
123°C |
증기압 |
0.000406mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|