3956-63-6 2,4-Dichlorophenoxyacetonitrile

상품명칭	2,4-Dichlorophenoxyacetonitrile
영문 이름	2,4-Dichlorophenoxyacetonitrile;
분자식	C₈H₅Cl₂NO
분자량	202.0374
InChI	InChI=1/C8H5Cl2NO/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5H,4H2
cas번호	3956-63-6
분자 구조
밀도	1.372g/cm³
녹는 점	46℃
비등점	311.8°C at 760 mmHg
굴절 지수	1.555
인화점	142.4°C
증기압	0.000549mmHg at 25°C
위험성 표시	Xn:Harmful;
리스크 규칙	R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
보안 규칙	S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.;