39635-11-5 3,4-Dihydroxybenzhydrazide

상품명칭	3,4-Dihydroxybenzhydrazide
영문 이름	3,4-Dihydroxybenzhydrazide; 3,4-Dihyroxybenzhydraide; 3,4-dihydroxybenzohydrazide
분자식	C₇H₈N₂O₃
분자량	168.15
InChI	InChI=1/C7H8N2O3/c8-9-7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H,8H2,(H,9,12)
cas번호	39635-11-5
EC번호	254-550-3
분자 구조
밀도	1.477g/cm³
굴절 지수	1.67
위험성 표시
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;