ChemNet > CAS > 3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
상품명칭 |
Methyl 3-chloro-4-hydroxybenzoate |
영문 이름 |
Methyl 3-chloro-4-hydroxybenzoate; 3-Chloro-4-hydroxybenzoic acid methyl ester; Methyl 3-chloro-4-hydroxy benzoate |
분자식 |
C8H7ClO3 |
분자량 |
186.5924 |
InChI |
InChI=1/C8H7ClO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,10H,1H3 |
cas번호 |
3964-57-6 |
EC번호 |
223-573-0 |
분자 구조 |
|
밀도 |
1.354g/cm3 |
녹는 점 |
106-107℃ |
비등점 |
284.9°C at 760 mmHg |
굴절 지수 |
1.564 |
인화점 |
126.1°C |
증기압 |
0.00168mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|