39828-35-8 2,4- dimethoxybenzoyl chloride

상품명칭	2,4- dimethoxybenzoyl chloride
영문 이름	2,4- dimethoxybenzoyl chloride; 2,4-DIMETHOXYBENZOYL CHLORIDE; benzoyl chloride, 2,4-dimethoxy-
분자식	C₉H₉ClO₃
분자량	200.619
InChI	InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3
cas번호	39828-35-8
분자 구조
밀도	1.224g/cm³
녹는 점	58℃
비등점	306.7°C at 760 mmHg
굴절 지수	1.52
인화점	134.1°C
증기압	0.000757mmHg at 25°C
위험성 표시	C:Corrosive;
리스크 규칙	R34:Causes burns.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;