ChemNet > CAS > 399-36-0 2',4'-Difluoroacetanilide
399-36-0 2',4'-Difluoroacetanilide
상품명칭 |
2',4'-Difluoroacetanilide |
영문 이름 |
2',4'-Difluoroacetanilide; 2,4-Difluoroacetanilide; N-(2,4-difluorophenyl)acetamide |
분자식 |
C8H7F2NO |
분자량 |
171.1441 |
InChI |
InChI=1/C8H7F2NO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,1H3,(H,11,12) |
cas번호 |
399-36-0 |
분자 구조 |
|
밀도 |
1.307g/cm3 |
비등점 |
276.8°C at 760 mmHg |
굴절 지수 |
1.531 |
인화점 |
121.2°C |
증기압 |
0.0047mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|