39931-77-6 Ethyl 3-pyridylacetate
상품명칭 |
Ethyl 3-pyridylacetate |
영문 이름 |
Ethyl 3-pyridylacetate; Ethyl pyridine-3-acetate; 3-Pyridylacetic acid ethyl ester; LABOTEST-BB LT00847594; 2-(3-pyridyl)-aceticaciethylester; 3-Pyridineacetic acid, ethyl ester; 3-pyridineaceticacid,ethylester; Acetic acid, 2-(3-pyridyl)-, ethyl ester; Ethyl 3-pyridineacetate; Ethyl 3-pyridinylacetate; Ethyl3-pyridylacetate,99%; Ethyl 3-pyridylacetate, GC 99%; ethyl pyridin-3-ylacetate |
분자식 |
C9H11NO2 |
분자량 |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)6-8-4-3-5-10-7-8/h3-5,7H,2,6H2,1H3 |
cas번호 |
39931-77-6 |
EC번호 |
254-707-6 |
분자 구조 |
|
밀도 |
1.086g/cm3 |
비등점 |
274.4°C at 760 mmHg |
굴절 지수 |
1.503 |
인화점 |
105.6°C |
증기압 |
0.00542mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|