ChemNet > CAS > 39959-59-6 4-Iodobenzylamine
39959-59-6 4-Iodobenzylamine
| 상품명칭 |
4-Iodobenzylamine |
| 영문 이름 |
4-Iodobenzylamine; 4-Iodo-benzylamine; 1-(4-iodophenyl)methanamine; 4-Iodobenzyl Amine |
| 분자식 |
C7H8IN |
| 분자량 |
233.0496 |
| InChI |
InChI=1/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| cas번호 |
39959-59-6 |
| 분자 구조 |
|
| 밀도 |
1.772g/cm3 |
| 비등점 |
250.4°C at 760 mmHg |
| 굴절 지수 |
1.644 |
| 인화점 |
105.2°C |
| 증기압 |
0.0217mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
