ChemNet > CAS > 39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
39974-94-2 5-Methoxy-1-methylindole-3-carboxaldehyde
상품명칭 |
5-Methoxy-1-methylindole-3-carboxaldehyde |
영문 이름 |
5-Methoxy-1-methylindole-3-carboxaldehyde; 3-Formyl-5-methoxy-1-methylindole; 5-methoxy-1-methyl-1H-indole-3-carbaldehyde |
분자식 |
C11H11NO2 |
분자량 |
189.2105 |
InChI |
InChI=1/C11H11NO2/c1-12-6-8(7-13)10-5-9(14-2)3-4-11(10)12/h3-7H,1-2H3 |
cas번호 |
39974-94-2 |
분자 구조 |
|
밀도 |
1.14g/cm3 |
비등점 |
357.9°C at 760 mmHg |
굴절 지수 |
1.565 |
인화점 |
170.2°C |
증기압 |
2.65E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|