ChemNet > CAS > 3999-55-1 Diethyl trans-1,2-cyclopropanedicarboxylate
3999-55-1 Diethyl trans-1,2-cyclopropanedicarboxylate
상품명칭 |
Diethyl trans-1,2-cyclopropanedicarboxylate |
영문 이름 |
Diethyl trans-1,2-cyclopropanedicarboxylate; diethyl (1R,2R)-cyclopropane-1,2-dicarboxylate |
분자식 |
C9H14O4 |
분자량 |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7(6)9(11)13-4-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1 |
cas번호 |
3999-55-1 |
분자 구조 |
|
밀도 |
1.153g/cm3 |
비등점 |
246.288°C at 760 mmHg |
굴절 지수 |
1.469 |
인화점 |
98.333°C |
증기압 |
0.027mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|