401-56-9 ethylchlorofluoroacetate
상품명칭 |
ethylchlorofluoroacetate |
영문 이름 |
ethylchlorofluoroacetate; Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
분자식 |
C4H6ClFO2 |
분자량 |
140.5406 |
InChI |
InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
cas번호 |
401-56-9 |
EC번호 |
206-930-5 |
분자 구조 |
|
밀도 |
1.219g/cm3 |
비등점 |
129°C at 760 mmHg |
굴절 지수 |
1.39 |
인화점 |
44.3°C |
증기압 |
10.4mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|