ChemNet > CAS > 402-63-1 1-(3-fluorophenyl)ethanol
402-63-1 1-(3-fluorophenyl)ethanol
상품명칭 |
1-(3-fluorophenyl)ethanol |
영문 이름 |
1-(3-fluorophenyl)ethanol; 3-fluorophenyl methyl carbinol; 3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol; 3-Fluoro-α-methylbenzenemethanol |
분자식 |
C8H9FO |
분자량 |
140.1549 |
InChI |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
cas번호 |
402-63-1 |
EC번호 |
206-950-4 |
분자 구조 |
|
밀도 |
1.123g/cm3 |
비등점 |
196.2°C at 760 mmHg |
굴절 지수 |
1.51 |
인화점 |
90.1°C |
증기압 |
0.251mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|