40228-90-8 7-Phenylheptanoic acid
상품명칭 |
7-Phenylheptanoic acid |
영문 이름 |
7-Phenylheptanoic acid; |
분자식 |
C13H18O2 |
분자량 |
206.2808 |
InChI |
InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
cas번호 |
40228-90-8 |
분자 구조 |
|
밀도 |
1.034g/cm3 |
비등점 |
356.5°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
253.5°C |
증기압 |
1.06E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|