ChemNet > CAS > 4066-41-5 5-Acetylthiophene-2-carboxylic acid
4066-41-5 5-Acetylthiophene-2-carboxylic acid
상품명칭 |
5-Acetylthiophene-2-carboxylic acid |
영문 이름 |
5-Acetylthiophene-2-carboxylic acid; -5-Acetyl-thiophene-2-carboxylic acid; ATC; LABOTEST-BB LT00454683; BUTTPARK 121\06-15; AKOS MSC-0226; 5-ACETYL-2-THIOPHENECARBOXYLIC ACID; RARECHEM AL BO 0535; 5-Acetylthiophene-2-CarboxylicAcid98%; 5-Acetylthiophene-2-Carboxylic Acid 98%; 5-acetylthiophene-2-carboxylate; 5-Acetyl-thiophene-2- carboxylic acid |
분자식 |
C7H6O3S |
분자량 |
170.1857 |
InChI |
InChI=1/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) |
cas번호 |
4066-41-5 |
분자 구조 |
|
밀도 |
1.383g/cm3 |
녹는 점 |
204-205℃ |
비등점 |
385.2°C at 760 mmHg |
굴절 지수 |
1.591 |
인화점 |
186.8°C |
증기압 |
1.27E-06mmHg at 25°C |
위험성 표시 |
Xi:;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|