ChemNet > CAS > 40750-59-2 3,4-Dichloro-N-methylaniline
40750-59-2 3,4-Dichloro-N-methylaniline
| 상품명칭 |
3,4-Dichloro-N-methylaniline |
| 영문 이름 |
3,4-Dichloro-N-methylaniline; N-Methyl-3,4-dichloroaniline; N1-Methyl-3,4-dichloroaniline |
| 분자식 |
C7H7Cl2N |
| 분자량 |
176.0432 |
| InChI |
InChI=1/C7H7Cl2N/c1-10-5-2-3-6(8)7(9)4-5/h2-4,10H,1H3 |
| cas번호 |
40750-59-2 |
| 분자 구조 |
|
| 밀도 |
1.325g/cm3 |
| 비등점 |
287.9°C at 760 mmHg |
| 굴절 지수 |
1.603 |
| 인화점 |
127.9°C |
| 증기압 |
0.00241mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
