ChemNet > CAS > 40763-96-0 5-Chloro-2-nitrobenzamide
40763-96-0 5-Chloro-2-nitrobenzamide
상품명칭 |
5-Chloro-2-nitrobenzamide |
영문 이름 |
5-Chloro-2-nitrobenzamide; |
분자식 |
C7H5ClN2O3 |
분자량 |
200.5792 |
InChI |
InChI=1/C7H5ClN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11) |
cas번호 |
40763-96-0 |
분자 구조 |
|
밀도 |
1.52g/cm3 |
녹는 점 |
157-160℃ |
비등점 |
301.7°C at 760 mmHg |
굴절 지수 |
1.624 |
인화점 |
136.3°C |
증기압 |
0.00103mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|