41051-88-1 p-Xylene-d10
상품명칭 |
p-Xylene-d10 |
영문 이름 |
p-Xylene-d10;(2H10)-p-Xylene; 1,4-bis[(~2~H_3_)methyl](~2~H_4_)benzene |
분자식 |
C8D10 |
분자량 |
116.2266 |
InChI |
InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
cas번호 |
41051-88-1 |
EC번호 |
255-193-6 |
분자 구조 |
|
밀도 |
0.952g/cm3 |
녹는 점 |
13℃ |
비등점 |
139.6°C at 760 mmHg |
굴절 지수 |
1.5 |
인화점 |
27.2°C |
증기압 |
7.94mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R38:Irritating to skin.;
|
보안 규칙 |
S25:Avoid contact with eyes.;
|
|