ChemNet > CAS > 41051-88-1 p-Xylene-d10
41051-88-1 p-Xylene-d10
| 상품명칭 |
p-Xylene-d10 |
| 영문 이름 |
p-Xylene-d10;(2H10)-p-Xylene; 1,4-bis[(~2~H_3_)methyl](~2~H_4_)benzene |
| 분자식 |
C8D10 |
| 분자량 |
116.2266 |
| InChI |
InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| cas번호 |
41051-88-1 |
| EC번호 |
255-193-6 |
| 분자 구조 |
|
| 밀도 |
0.952g/cm3 |
| 녹는 점 |
13℃ |
| 비등점 |
139.6°C at 760 mmHg |
| 굴절 지수 |
1.5 |
| 인화점 |
27.2°C |
| 증기압 |
7.94mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R38:Irritating to skin.;
|
| 보안 규칙 |
S25:Avoid contact with eyes.;
|
|
