4110-50-3 Ethyl n-propyl sulfide
상품명칭 |
Ethyl n-propyl sulfide |
영문 이름 |
Ethyl n-propyl sulfide; Ethyl n-propyl sulphide; 1-(ethylsulfanyl)propane; 3-(chloromethyl)-1,2,4,5-tetramethylbenzene; Ethyl propyl sulfide |
분자식 |
C11H15Cl |
분자량 |
182.6898 |
InChI |
InChI=1/C11H15Cl/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5H,6H2,1-4H3 |
cas번호 |
4110-50-3 |
EC번호 |
223-890-4 |
분자 구조 |
|
밀도 |
1.002g/cm3 |
비등점 |
269.4°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
113.8°C |
증기압 |
0.012mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|