ChemNet > CAS > 4151-80-8 4,4'-Biphenyldiboronic acid
4151-80-8 4,4'-Biphenyldiboronic acid
상품명칭 |
4,4'-Biphenyldiboronic acid |
영문 이름 |
4,4'-Biphenyldiboronic acid;biphenyl-4,4'-diyldiboronic acid |
분자식 |
C12H12B2O4 |
분자량 |
241.8433 |
InChI |
InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H |
cas번호 |
4151-80-8 |
분자 구조 |
|
밀도 |
1.31g/cm3 |
녹는 점 |
300℃ (dec.) |
비등점 |
505.9°C at 760 mmHg |
굴절 지수 |
1.62 |
인화점 |
259.7°C |
증기압 |
4.69E-11mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|