ChemNet > CAS > 4166-53-4 3-Methylglutaric anhydride
4166-53-4 3-Methylglutaric anhydride
상품명칭 |
3-Methylglutaric anhydride |
영문 이름 |
3-Methylglutaric anhydride; 4-methyldihydro-2H-pyran-2,6(3H)-dione |
분자식 |
C6H8O3 |
분자량 |
128.1259 |
InChI |
InChI=1/C6H8O3/c1-4-2-5(7)9-6(8)3-4/h4H,2-3H2,1H3 |
cas번호 |
4166-53-4 |
EC번호 |
224-020-6 |
분자 구조 |
|
밀도 |
1.159g/cm3 |
녹는 점 |
40-45℃ |
비등점 |
299.5°C at 760 mmHg |
굴절 지수 |
1.448 |
인화점 |
113°C |
증기압 |
0.00119mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|