ChemNet > CAS > 41667-95-2 5,6-dichloronicotinic acid
41667-95-2 5,6-dichloronicotinic acid
상품명칭 |
5,6-dichloronicotinic acid |
영문 이름 |
5,6-dichloronicotinic acid; 5,6-Dichloropyridine-3-carboxylic acid; 5,6-dichloro nicotinic acid |
분자식 |
C6H3Cl2NO2 |
분자량 |
191.9995 |
InChI |
InChI=1/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
cas번호 |
41667-95-2 |
분자 구조 |
|
밀도 |
1.612g/cm3 |
녹는 점 |
164-168℃ |
비등점 |
342.1°C at 760 mmHg |
굴절 지수 |
1.605 |
인화점 |
160.7°C |
증기압 |
2.96E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:;
S24/25:;
|
|