ChemNet > CAS > 41727-47-3 3,5-Dibromo-4-hydroxybenzoic acid methyl ester
41727-47-3 3,5-Dibromo-4-hydroxybenzoic acid methyl ester
| 상품명칭 |
3,5-Dibromo-4-hydroxybenzoic acid methyl ester |
| 영문 이름 |
3,5-Dibromo-4-hydroxybenzoic acid methyl ester; Methyl 3,5-dibromo-4-hydroxybenzoate |
| 분자식 |
C8H6Br2O3 |
| 분자량 |
309.9394 |
| InChI |
InChI=1/C8H6Br2O3/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3,11H,1H3 |
| cas번호 |
41727-47-3 |
| EC번호 |
255-521-8 |
| 분자 구조 |
|
| 밀도 |
1.96g/cm3 |
| 녹는 점 |
122℃ |
| 비등점 |
297.2°C at 760 mmHg |
| 굴절 지수 |
1.616 |
| 인화점 |
133.5°C |
| 증기압 |
0.000775mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
