ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
| 상품명칭 |
2-Bromo-4,6-dimethylaniline |
| 영문 이름 |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
| 분자식 |
C8H10BrN |
| 분자량 |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| cas번호 |
41825-73-4 |
| EC번호 |
246-337-9 |
| 분자 구조 |
|
| 밀도 |
1.424g/cm3 |
| 녹는 점 |
49-79℃ |
| 비등점 |
260.9°C at 760 mmHg |
| 굴절 지수 |
1.596 |
| 인화점 |
111.6°C |
| 증기압 |
0.0119mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
