ChemNet > CAS > 41963-20-6 4-Bromo-3-methylbenzonitrile
41963-20-6 4-Bromo-3-methylbenzonitrile
| 상품명칭 |
4-Bromo-3-methylbenzonitrile |
| 영문 이름 |
4-Bromo-3-methylbenzonitrile; 4-Bromo-m-tolunitrile (CN=1); 3-Methyl-4-bromobenzonitrile |
| 분자식 |
C8H6BrN |
| 분자량 |
196.0439 |
| InChI |
InChI=1/C8H6BrN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,1H3 |
| cas번호 |
41963-20-6 |
| 분자 구조 |
|
| 밀도 |
1.51g/cm3 |
| 비등점 |
265°C at 760 mmHg |
| 굴절 지수 |
1.59 |
| 인화점 |
114.1°C |
| 증기압 |
0.00937mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
