ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
| 상품명칭 |
2-Chloro-6-iodotoluene |
| 영문 이름 |
2-Chloro-6-iodotoluene; 1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
| 분자식 |
C7H6ClI |
| 분자량 |
252.48 |
| InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| cas번호 |
42048-11-3 |
| 분자 구조 |
|
| 밀도 |
1.806g/cm3 |
| 비등점 |
243°C at 760 mmHg |
| 굴절 지수 |
1.616 |
| 인화점 |
100.8°C |
| 증기압 |
0.0513mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
