ChemNet > CAS > 42182-27-4 2-Amino-4-cyanopyridine
42182-27-4 2-Amino-4-cyanopyridine
| 상품명칭 |
2-Amino-4-cyanopyridine |
| 영문 이름 |
2-Amino-4-cyanopyridine; 2-Aminoisonicotinonitrile; 4-Cyano-2-pyridinamine; 2-aminopyridine-4-carbonitrile |
| 분자식 |
C6H5N3 |
| 분자량 |
119.124 |
| InChI |
InChI=1/C6H5N3/c7-4-5-1-2-9-6(8)3-5/h1-3H,(H2,8,9) |
| cas번호 |
42182-27-4 |
| 분자 구조 |
|
| 밀도 |
1.23g/cm3 |
| 비등점 |
297.7°C at 760 mmHg |
| 굴절 지수 |
1.594 |
| 인화점 |
133.8°C |
| 증기압 |
0.00133mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
