ChemNet > CAS > 423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
423768-53-0 ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate
상품명칭 |
ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate |
영문 이름 |
ethyl 1-cyclopropyl-4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate; |
분자식 |
C13H17NO3 |
분자량 |
235.279 |
InChI |
InChI=1/C13H17NO3/c1-4-17-13(16)12-9(3)14(10-5-6-10)8(2)11(12)7-15/h7,10H,4-6H2,1-3H3 |
cas번호 |
423768-53-0 |
분자 구조 |
|
밀도 |
1.21g/cm3 |
녹는 점 |
75℃ |
비등점 |
391.9°C at 760 mmHg |
굴절 지수 |
1.571 |
인화점 |
190.8°C |
증기압 |
2.38E-06mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|