ChemNet > CAS > 423768-54-1 2-morpholinonicotinic acid
423768-54-1 2-morpholinonicotinic acid
| 상품명칭 |
2-morpholinonicotinic acid |
| 영문 이름 |
2-morpholinonicotinic acid;2-morpholin-4-ylpyridine-3-carboxylic acid |
| 분자식 |
C10H12N2O3 |
| 분자량 |
208.2139 |
| InChI |
InChI=1/C10H12N2O3/c13-10(14)8-2-1-3-11-9(8)12-4-6-15-7-5-12/h1-3H,4-7H2,(H,13,14) |
| cas번호 |
423768-54-1 |
| 분자 구조 |
|
| 밀도 |
1.313g/cm3 |
| 녹는 점 |
130℃ |
| 비등점 |
418°C at 760 mmHg |
| 굴절 지수 |
1.584 |
| 인화점 |
206.6°C |
| 증기압 |
9.78E-08mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
