4250-77-5 6-Hydroxyflavanone
상품명칭 |
6-Hydroxyflavanone |
영문 이름 |
6-Hydroxyflavanone;(2R)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; 6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
분자식 |
C15H12O3 |
분자량 |
240.254 |
InChI |
InChI=1/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
cas번호 |
4250-77-5 |
분자 구조 |
|
밀도 |
1.288g/cm3 |
녹는 점 |
220-222℃ |
비등점 |
464.3°C at 760 mmHg |
굴절 지수 |
1.631 |
인화점 |
181.2°C |
증기압 |
3.05E-09mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|