ChemNet > CAS > 42754-62-1 5-아미노-3-(4-클로로페닐)-1H-피라졸-4-카르보니트릴
42754-62-1 5-아미노-3-(4-클로로페닐)-1H-피라졸-4-카르보니트릴
| 상품명칭 |
5-아미노-3-(4-클로로페닐)-1H-피라졸-4-카르보니트릴 |
| 별명 |
3-아미노-5-(4-클로로페닐)-1H-피라졸-4-카르보니트릴 |
| 영문 이름 |
5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile;3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| 분자식 |
C10H7ClN4 |
| 분자량 |
218.6424 |
| InChI |
InChI=1/C10H7ClN4/c11-7-3-1-6(2-4-7)9-8(5-12)10(13)15-14-9/h1-4H,(H3,13,14,15) |
| cas번호 |
42754-62-1 |
| 분자 구조 |
|
| 밀도 |
1.48g/cm3 |
| 녹는 점 |
212℃ |
| 비등점 |
554.7°C at 760 mmHg |
| 굴절 지수 |
1.688 |
| 인화점 |
289.3°C |
| 증기압 |
2.41E-12mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
