4312-99-6 1-Octen-3-one
상품명칭 |
1-Octen-3-one |
영문 이름 |
1-Octen-3-one; n-Amyl vinyl ketone~n-Pentyl vinyl ketone; oct-1-en-3-one |
분자식 |
C8H14O |
분자량 |
126.1962 |
InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
cas번호 |
4312-99-6 |
EC번호 |
224-327-5 |
분자 구조 |
|
밀도 |
0.825g/cm3 |
비등점 |
177°C at 760 mmHg |
굴절 지수 |
1.422 |
인화점 |
58.5°C |
증기압 |
1.06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|